C16H12BrFN2S2 — CID 2826138
1-(1-benzothiophen-3-ylmethyl)-3-(2-bromo-4-fluorophenyl)thiourea (PubChem CID 2826138) has the molecular formula C16H12BrFN2S2 and a molecular weight of 395.32 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-ylmethyl)-3-(2-bromo-4-fluorophenyl)thiourea.
| Compound Name | 1-(1-benzothiophen-3-ylmethyl)-3-(2-bromo-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 2826138 |
| Molecular Formula | C16H12BrFN2S2 |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 1-(1-benzothiophen-3-ylmethyl)-3-(2-bromo-4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)NCc2csc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C16H12BrFN2S2/c17-13-7-11(18)5-6-14(13)20-16(21)19-8-10-9-22-15-4-2-1-3-12(10)15/h1-7,9H,8H2,(H2,19,20,21) |
| InChIKey | NUWHFKJFMCWHOJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|