C17H17NS — CID 63418099
N-(1-benzothiophen-3-ylmethyl)-2,4-dimethylaniline (PubChem CID 63418099) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-2,4-dimethylaniline.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-2,4-dimethylaniline |
|---|---|
| PubChem CID | 63418099 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-2,4-dimethylaniline |
| SMILES | Cc1ccc(NCc2csc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C17H17NS/c1-12-7-8-16(13(2)9-12)18-10-14-11-19-17-6-4-3-5-15(14)17/h3-9,11,18H,10H2,1-2H3 |
| InChIKey | HONCVHTYJAZXTQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |