C15H10BrF2NS — CID 107609618
N-(1-benzothiophen-3-ylmethyl)-4-bromo-2,5-difluoroaniline (PubChem CID 107609618) has the molecular formula C15H10BrF2NS and a molecular weight of 354.22 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-4-bromo-2,5-difluoroaniline.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-4-bromo-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107609618 |
| Molecular Formula | C15H10BrF2NS |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-4-bromo-2,5-difluoroaniline |
| SMILES | Fc1cc(NCc2csc3ccccc23)c(F)cc1Br |
| InChI | InChI=1S/C15H10BrF2NS/c16-11-5-13(18)14(6-12(11)17)19-7-9-8-20-15-4-2-1-3-10(9)15/h1-6,8,19H,7H2 |
| InChIKey | SBOGNASXFZPNOA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|