C16H13Br2NOS — CID 103411269
N-(1-benzothiophen-3-ylmethyl)-2,4-dibromo-5-methoxyaniline (PubChem CID 103411269) has the molecular formula C16H13Br2NOS and a molecular weight of 427.16 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-2,4-dibromo-5-methoxyaniline.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-2,4-dibromo-5-methoxyaniline |
|---|---|
| PubChem CID | 103411269 |
| Molecular Formula | C16H13Br2NOS |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 424.91 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-2,4-dibromo-5-methoxyaniline |
| SMILES | COc1cc(NCc2csc3ccccc23)c(Br)cc1Br |
| InChI | InChI=1S/C16H13Br2NOS/c1-20-15-7-14(12(17)6-13(15)18)19-8-10-9-21-16-5-3-2-4-11(10)16/h2-7,9,19H,8H2,1H3 |
| InChIKey | MMYQXLLGFPXLOQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |