C17H17NO2S — CID 60962379
N-(1-benzothiophen-3-ylmethyl)-3,4-dimethoxyaniline (PubChem CID 60962379) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-3,4-dimethoxyaniline.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 60962379 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-3,4-dimethoxyaniline |
| SMILES | COc1ccc(NCc2csc3ccccc23)cc1OC |
| InChI | InChI=1S/C17H17NO2S/c1-19-15-8-7-13(9-16(15)20-2)18-10-12-11-21-17-6-4-3-5-14(12)17/h3-9,11,18H,10H2,1-2H3 |
| InChIKey | SJFHPVBMLBYNJM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|