C19H18O2S — CID 141154304
3-[2-(3,4-dimethoxyphenyl)prop-2-enyl]-1-benzothiophene (PubChem CID 141154304) has the molecular formula C19H18O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)prop-2-enyl]-1-benzothiophene.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)prop-2-enyl]-1-benzothiophene |
|---|---|
| PubChem CID | 141154304 |
| Molecular Formula | C19H18O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)prop-2-enyl]-1-benzothiophene |
| SMILES | C=C(Cc1csc2ccccc12)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H18O2S/c1-13(14-8-9-17(20-2)18(11-14)21-3)10-15-12-22-19-7-5-4-6-16(15)19/h4-9,11-12H,1,10H2,2-3H3 |
| InChIKey | WIYQWGJTCAEXTP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |