C26H24N2O5S — CID 55785516
N-(1-benzothiophen-3-ylmethyl)-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide (PubChem CID 55785516) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55785516 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(C(=O)NCc2csc3ccccc23)cc1OC |
| InChI | InChI=1S/C26H24N2O5S/c1-31-21-9-5-4-8-20(21)28-25(29)15-33-22-12-11-17(13-23(22)32-2)26(30)27-14-18-16-34-24-10-6-3-7-19(18)24/h3-13,16H,14-15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | JZIQAXVXZZSDCH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |