C22H27N3O7 — CID 56558869
ethyl N-[2-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoyl]amino]ethyl]carbamate (PubChem CID 56558869) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is ethyl N-[2-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56558869 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | ethyl N-[2-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)c1ccc(OCC(=O)Nc2ccccc2OC)c(OC)c1 |
| InChI | InChI=1S/C22H27N3O7/c1-4-31-22(28)24-12-11-23-21(27)15-9-10-18(19(13-15)30-3)32-14-20(26)25-16-7-5-6-8-17(16)29-2/h5-10,13H,4,11-12,14H2,1-3H3,(H,23,27)(H,24,28)(H,25,26) |
| InChIKey | KJWQSLQTYVPKKW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|