C26H27N3O6 — CID 55676193
N-[2-(benzylamino)-2-oxoethyl]-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide (PubChem CID 55676193) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxoethyl]-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-[2-(benzylamino)-2-oxoethyl]-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55676193 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[2-(benzylamino)-2-oxoethyl]-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(C(=O)NCC(=O)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H27N3O6/c1-33-21-11-7-6-10-20(21)29-25(31)17-35-22-13-12-19(14-23(22)34-2)26(32)28-16-24(30)27-15-18-8-4-3-5-9-18/h3-14H,15-17H2,1-2H3,(H,27,30)(H,28,32)(H,29,31) |
| InChIKey | CFJWUEMGUYFIAS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |