C23H21IN2O5 — CID 2418372
N-(3-iodophenyl)-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide (PubChem CID 2418372) has the molecular formula C23H21IN2O5 and a molecular weight of 532.33 g/mol. Its IUPAC name is N-(3-iodophenyl)-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-(3-iodophenyl)-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 2418372 |
| Molecular Formula | C23H21IN2O5 |
| Molecular Weight | 532.33 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | N-(3-iodophenyl)-3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(C(=O)Nc2cccc(I)c2)cc1OC |
| InChI | InChI=1S/C23H21IN2O5/c1-29-19-9-4-3-8-18(19)26-22(27)14-31-20-11-10-15(12-21(20)30-2)23(28)25-17-7-5-6-16(24)13-17/h3-13H,14H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | NVNWNROQIGDQKA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|