C20H21N3O4S — CID 90062100
N-[2-[2-(1-benzothiophen-3-ylmethyl)hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 90062100) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[2-[2-(1-benzothiophen-3-ylmethyl)hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[2-(1-benzothiophen-3-ylmethyl)hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 90062100 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[2-[2-(1-benzothiophen-3-ylmethyl)hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NNCc2csc3ccccc23)cc1OC |
| InChI | InChI=1S/C20H21N3O4S/c1-26-16-8-7-13(9-17(16)27-2)20(25)21-11-19(24)23-22-10-14-12-28-18-6-4-3-5-15(14)18/h3-9,12,22H,10-11H2,1-2H3,(H,21,25)(H,23,24) |
| InChIKey | TVRWWMIVVDIMRV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|