C28H33N3O4S — CID 123627431
N-[2-[2-[1-(1-benzothiophen-3-yl)-3-cyclohexylpropylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 123627431) has the molecular formula C28H33N3O4S and a molecular weight of 507.66 g/mol. Its IUPAC name is N-[2-[2-[1-(1-benzothiophen-3-yl)-3-cyclohexylpropylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[2-[1-(1-benzothiophen-3-yl)-3-cyclohexylpropylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 123627431 |
| Molecular Formula | C28H33N3O4S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-[2-[2-[1-(1-benzothiophen-3-yl)-3-cyclohexylpropylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NN=C(CCC2CCCCC2)c2csc3ccccc23)cc1OC |
| InChI | InChI=1S/C28H33N3O4S/c1-34-24-15-13-20(16-25(24)35-2)28(33)29-17-27(32)31-30-23(14-12-19-8-4-3-5-9-19)22-18-36-26-11-7-6-10-21(22)26/h6-7,10-11,13,15-16,18-19H,3-5,8-9,12,14,17H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | KATSYXYUEFLION-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|