C26H30N2O4S — CID 158835820
N-[(Z)-1-(1-benzothiophen-3-yl)hexylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide (PubChem CID 158835820) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[(Z)-1-(1-benzothiophen-3-yl)hexylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide.
| Compound Name | N-[(Z)-1-(1-benzothiophen-3-yl)hexylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 158835820 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[(Z)-1-(1-benzothiophen-3-yl)hexylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide |
| SMILES | CCCCC/C(=N/NC(=O)CCC(=O)c1ccc(OC)c(OC)c1)c1csc2ccccc12 |
| InChI | InChI=1S/C26H30N2O4S/c1-4-5-6-10-21(20-17-33-25-11-8-7-9-19(20)25)27-28-26(30)15-13-22(29)18-12-14-23(31-2)24(16-18)32-3/h7-9,11-12,14,16-17H,4-6,10,13,15H2,1-3H3,(H,28,30)/b27-21- |
| InChIKey | QQHOKTPEGVCFAI-MEFGMAGPSA-N |
| XLogP | 5.98 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|