C24H25FN2O5S — CID 160625527
4-(3,4-dimethoxyphenyl)-N-[(Z)-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]amino]-4-oxobutanamide (PubChem CID 160625527) has the molecular formula C24H25FN2O5S and a molecular weight of 472.54 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-[(Z)-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]amino]-4-oxobutanamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-[(Z)-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]amino]-4-oxobutanamide |
|---|---|
| PubChem CID | 160625527 |
| Molecular Formula | C24H25FN2O5S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-[(Z)-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]amino]-4-oxobutanamide |
| SMILES | COCC/C(=N/NC(=O)CCC(=O)c1ccc(OC)c(OC)c1)c1csc2c(F)cccc12 |
| InChI | InChI=1S/C24H25FN2O5S/c1-30-12-11-19(17-14-33-24-16(17)5-4-6-18(24)25)26-27-23(29)10-8-20(28)15-7-9-21(31-2)22(13-15)32-3/h4-7,9,13-14H,8,10-12H2,1-3H3,(H,27,29)/b26-19- |
| InChIKey | HNLXWSWCNFQZDD-XHPQRKPJSA-N |
| XLogP | 4.58 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|