C24H25FN2O5S — CID 172957118
N-[(E)-1-(7-fluoro-1-benzothiophen-3-yl)ethylideneamino]-4-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-N-methyl-4-oxobutanamide (PubChem CID 172957118) has the molecular formula C24H25FN2O5S and a molecular weight of 472.54 g/mol. Its IUPAC name is N-[(E)-1-(7-fluoro-1-benzothiophen-3-yl)ethylideneamino]-4-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-N-methyl-4-oxobutanamide.
| Compound Name | N-[(E)-1-(7-fluoro-1-benzothiophen-3-yl)ethylideneamino]-4-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 172957118 |
| Molecular Formula | C24H25FN2O5S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[(E)-1-(7-fluoro-1-benzothiophen-3-yl)ethylideneamino]-4-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-N-methyl-4-oxobutanamide |
| SMILES | COc1cc(C(=O)CCC(=O)N(C)/N=C(\C)c2csc3c(F)cccc23)ccc1OCCO |
| InChI | InChI=1S/C24H25FN2O5S/c1-15(18-14-33-24-17(18)5-4-6-19(24)25)26-27(2)23(30)10-8-20(29)16-7-9-21(32-12-11-28)22(13-16)31-3/h4-7,9,13-14,28H,8,10-12H2,1-3H3/b26-15+ |
| InChIKey | GGHHKUVNZGTYGV-CVKSISIWSA-N |
| XLogP | 4.27 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|