C30H36FN3O7S — CID 144580045
2-[4-[[2-[[(E)-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]amino]-methylamino]-2-oxoethyl]carbamoyl]-2-methoxyphenoxy]ethyl 3-methylbutanoate (PubChem CID 144580045) has the molecular formula C30H36FN3O7S and a molecular weight of 601.70 g/mol. Its IUPAC name is 2-[4-[[2-[[(E)-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]amino]-methylamino]-2-oxoethyl]carbamoyl]-2-methoxyphenoxy]ethyl 3-methylbutanoate.
| Compound Name | 2-[4-[[2-[[(E)-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]amino]-methylamino]-2-oxoethyl]carbamoyl]-2-methoxyphenoxy]ethyl 3-methylbutanoate |
|---|---|
| PubChem CID | 144580045 |
| Molecular Formula | C30H36FN3O7S |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 2-[4-[[2-[[(E)-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]amino]-methylamino]-2-oxoethyl]carbamoyl]-2-methoxyphenoxy]ethyl 3-methylbutanoate |
| SMILES | COCC/C(=N\N(C)C(=O)CNC(=O)c1ccc(OCCOC(=O)CC(C)C)c(OC)c1)c1csc2c(F)cccc12 |
| InChI | InChI=1S/C30H36FN3O7S/c1-19(2)15-28(36)41-14-13-40-25-10-9-20(16-26(25)39-5)30(37)32-17-27(35)34(3)33-24(11-12-38-4)22-18-42-29-21(22)7-6-8-23(29)31/h6-10,16,18-19H,11-15,17H2,1-5H3,(H,32,37)/b33-24+ |
| InChIKey | ZSPOJXZJQQGLMY-IWBSIUBASA-N |
| XLogP | 4.65 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|