C23H23FN2O5S — CID 172919153
N-[(E)-(7-fluoro-1-benzothiophen-3-yl)methylideneamino]-4-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-N-methyl-4-oxobutanamide (PubChem CID 172919153) has the molecular formula C23H23FN2O5S and a molecular weight of 458.51 g/mol. Its IUPAC name is N-[(E)-(7-fluoro-1-benzothiophen-3-yl)methylideneamino]-4-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-N-methyl-4-oxobutanamide.
| Compound Name | N-[(E)-(7-fluoro-1-benzothiophen-3-yl)methylideneamino]-4-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 172919153 |
| Molecular Formula | C23H23FN2O5S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[(E)-(7-fluoro-1-benzothiophen-3-yl)methylideneamino]-4-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-N-methyl-4-oxobutanamide |
| SMILES | COc1cc(C(=O)CCC(=O)N(C)/N=C/c2csc3c(F)cccc23)ccc1OCCO |
| InChI | InChI=1S/C23H23FN2O5S/c1-26(25-13-16-14-32-23-17(16)4-3-5-18(23)24)22(29)9-7-19(28)15-6-8-20(31-11-10-27)21(12-15)30-2/h3-6,8,12-14,27H,7,9-11H2,1-2H3/b25-13+ |
| InChIKey | FCEORNRUOZMNSH-DHRITJCHSA-N |
| XLogP | 3.88 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|