C24H22FN3O5S — CID 172939813
N-[(E)-(2-cyano-7-fluoro-1-benzothiophen-3-yl)methylideneamino]-4-[3-(2-hydroxyethoxy)-4-methoxyphenyl]-N-methyl-4-oxobutanamide (PubChem CID 172939813) has the molecular formula C24H22FN3O5S and a molecular weight of 483.52 g/mol. Its IUPAC name is N-[(E)-(2-cyano-7-fluoro-1-benzothiophen-3-yl)methylideneamino]-4-[3-(2-hydroxyethoxy)-4-methoxyphenyl]-N-methyl-4-oxobutanamide.
| Compound Name | N-[(E)-(2-cyano-7-fluoro-1-benzothiophen-3-yl)methylideneamino]-4-[3-(2-hydroxyethoxy)-4-methoxyphenyl]-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 172939813 |
| Molecular Formula | C24H22FN3O5S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | N-[(E)-(2-cyano-7-fluoro-1-benzothiophen-3-yl)methylideneamino]-4-[3-(2-hydroxyethoxy)-4-methoxyphenyl]-N-methyl-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)N(C)/N=C/c2c(C#N)sc3c(F)cccc23)cc1OCCO |
| InChI | InChI=1S/C24H22FN3O5S/c1-28(27-14-17-16-4-3-5-18(25)24(16)34-22(17)13-26)23(31)9-7-19(30)15-6-8-20(32-2)21(12-15)33-11-10-29/h3-6,8,12,14,29H,7,9-11H2,1-2H3/b27-14+ |
| InChIKey | QPNPXQLRWNHDQT-MZJWZYIUSA-N |
| XLogP | 3.75 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|