C18H18F3NO4 — CID 55734454
3-(2-hydroxyethoxy)-4-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 55734454) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 3-(2-hydroxyethoxy)-4-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 3-(2-hydroxyethoxy)-4-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55734454 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-(2-hydroxyethoxy)-4-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCc2cccc(C(F)(F)F)c2)cc1OCCO |
| InChI | InChI=1S/C18H18F3NO4/c1-25-15-6-5-13(10-16(15)26-8-7-23)17(24)22-11-12-3-2-4-14(9-12)18(19,20)21/h2-6,9-10,23H,7-8,11H2,1H3,(H,22,24) |
| InChIKey | UXCQJQQGRKBIKN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |