C29H35FN4O7S — CID 131981950
2-[4-[[2-[(2E)-2-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]hydrazinyl]-2-oxoethyl]carbamoyl]-2-methoxyphenoxy]ethyl (2S)-2-amino-3-methylbutanoate (PubChem CID 131981950) has the molecular formula C29H35FN4O7S and a molecular weight of 602.69 g/mol. Its IUPAC name is 2-[4-[[2-[(2E)-2-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]hydrazinyl]-2-oxoethyl]carbamoyl]-2-methoxyphenoxy]ethyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | 2-[4-[[2-[(2E)-2-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]hydrazinyl]-2-oxoethyl]carbamoyl]-2-methoxyphenoxy]ethyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 131981950 |
| Molecular Formula | C29H35FN4O7S |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 2-[4-[[2-[(2E)-2-[1-(7-fluoro-1-benzothiophen-3-yl)-3-methoxypropylidene]hydrazinyl]-2-oxoethyl]carbamoyl]-2-methoxyphenoxy]ethyl (2S)-2-amino-3-methylbutanoate |
| SMILES | COCC/C(=N\NC(=O)CNC(=O)c1ccc(OCCOC(=O)[C@@H](N)C(C)C)c(OC)c1)c1csc2c(F)cccc12 |
| InChI | InChI=1S/C29H35FN4O7S/c1-17(2)26(31)29(37)41-13-12-40-23-9-8-18(14-24(23)39-4)28(36)32-15-25(35)34-33-22(10-11-38-3)20-16-42-27-19(20)6-5-7-21(27)30/h5-9,14,16-17,26H,10-13,15,31H2,1-4H3,(H,32,36)(H,34,35)/b33-22+/t26-/m0/s1 |
| InChIKey | KSHFTRHDENJFLQ-KBPINPGLSA-N |
| XLogP | 3.24 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|