C23H25N3O4S — CID 90061450
N-[2-[(2E)-2-[1-(1-benzothiophen-3-yl)ethylidene]hydrazinyl]-2-oxoethyl]-3,4-diethoxybenzamide (PubChem CID 90061450) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[2-[(2E)-2-[1-(1-benzothiophen-3-yl)ethylidene]hydrazinyl]-2-oxoethyl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-[(2E)-2-[1-(1-benzothiophen-3-yl)ethylidene]hydrazinyl]-2-oxoethyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 90061450 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[2-[(2E)-2-[1-(1-benzothiophen-3-yl)ethylidene]hydrazinyl]-2-oxoethyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)N/N=C(\C)c2csc3ccccc23)cc1OCC |
| InChI | InChI=1S/C23H25N3O4S/c1-4-29-19-11-10-16(12-20(19)30-5-2)23(28)24-13-22(27)26-25-15(3)18-14-31-21-9-7-6-8-17(18)21/h6-12,14H,4-5,13H2,1-3H3,(H,24,28)(H,26,27)/b25-15+ |
| InChIKey | AHXDJTWFRFREOP-MFKUBSTISA-N |
| XLogP | 3.97 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|