C26H31N3O3S — CID 172927602
N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[4-(diethylamino)-3-ethoxyphenyl]-4-oxobutanamide (PubChem CID 172927602) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[4-(diethylamino)-3-ethoxyphenyl]-4-oxobutanamide.
| Compound Name | N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[4-(diethylamino)-3-ethoxyphenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 172927602 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[4-(diethylamino)-3-ethoxyphenyl]-4-oxobutanamide |
| SMILES | CCOc1cc(C(=O)CCC(=O)N/N=C(\C)c2csc3ccccc23)ccc1N(CC)CC |
| InChI | InChI=1S/C26H31N3O3S/c1-5-29(6-2)22-13-12-19(16-24(22)32-7-3)23(30)14-15-26(31)28-27-18(4)21-17-33-25-11-9-8-10-20(21)25/h8-13,16-17H,5-7,14-15H2,1-4H3,(H,28,31)/b27-18+ |
| InChIKey | WEVXLDXTTRRZCC-OVVQPSECSA-N |
| XLogP | 5.65 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|