C28H36N4O2S — CID 172927601
N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[3,4-bis(diethylamino)phenyl]-4-oxobutanamide (PubChem CID 172927601) has the molecular formula C28H36N4O2S and a molecular weight of 492.69 g/mol. Its IUPAC name is N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[3,4-bis(diethylamino)phenyl]-4-oxobutanamide.
| Compound Name | N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[3,4-bis(diethylamino)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 172927601 |
| Molecular Formula | C28H36N4O2S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[3,4-bis(diethylamino)phenyl]-4-oxobutanamide |
| SMILES | CCN(CC)c1ccc(C(=O)CCC(=O)N/N=C(\C)c2csc3ccccc23)cc1N(CC)CC |
| InChI | InChI=1S/C28H36N4O2S/c1-6-31(7-2)24-15-14-21(18-25(24)32(8-3)9-4)26(33)16-17-28(34)30-29-20(5)23-19-35-27-13-11-10-12-22(23)27/h10-15,18-19H,6-9,16-17H2,1-5H3,(H,30,34)/b29-20+ |
| InChIKey | WENFGNXCOJLVSY-ZTKZIYFRSA-N |
| XLogP | 6.10 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|