C24H27N3O2S — CID 172952671
N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[4-(diethylamino)phenyl]-4-oxobutanamide (PubChem CID 172952671) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[4-(diethylamino)phenyl]-4-oxobutanamide.
| Compound Name | N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[4-(diethylamino)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 172952671 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[(E)-1-(1-benzothiophen-3-yl)ethylideneamino]-4-[4-(diethylamino)phenyl]-4-oxobutanamide |
| SMILES | CCN(CC)c1ccc(C(=O)CCC(=O)N/N=C(\C)c2csc3ccccc23)cc1 |
| InChI | InChI=1S/C24H27N3O2S/c1-4-27(5-2)19-12-10-18(11-13-19)22(28)14-15-24(29)26-25-17(3)21-16-30-23-9-7-6-8-20(21)23/h6-13,16H,4-5,14-15H2,1-3H3,(H,26,29)/b25-17+ |
| InChIKey | WQFHJTBNISQEJD-KOEQRZSOSA-N |
| XLogP | 5.25 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|