C12H8O4S — CID 510857
4-(1-benzothiophen-3-yl)-2,4-dioxobutanoic acid (PubChem CID 510857) has the molecular formula C12H8O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-2,4-dioxobutanoic acid.
| Compound Name | 4-(1-benzothiophen-3-yl)-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 510857 |
| Molecular Formula | C12H8O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 4-(1-benzothiophen-3-yl)-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C12H8O4S/c13-9(5-10(14)12(15)16)8-6-17-11-4-2-1-3-7(8)11/h1-4,6H,5H2,(H,15,16) |
| InChIKey | RKGSZZRPLHINBJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|