C16H20OS — CID 114201676
1-(1-benzothiophen-3-yl)-3,5-dimethylhexan-1-one (PubChem CID 114201676) has the molecular formula C16H20OS and a molecular weight of 260.40 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3,5-dimethylhexan-1-one.
| Compound Name | 1-(1-benzothiophen-3-yl)-3,5-dimethylhexan-1-one |
|---|---|
| PubChem CID | 114201676 |
| Molecular Formula | C16H20OS |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3,5-dimethylhexan-1-one |
| SMILES | CC(C)CC(C)CC(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C16H20OS/c1-11(2)8-12(3)9-15(17)14-10-18-16-7-5-4-6-13(14)16/h4-7,10-12H,8-9H2,1-3H3 |
| InChIKey | ZZGKZSYQOYDWJR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |