C10H7FO4 — CID 23090222
4-(2-fluorophenyl)-2,4-dioxobutanoic acid (PubChem CID 23090222) has the molecular formula C10H7FO4 and a molecular weight of 210.16 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-2,4-dioxobutanoic acid.
| Compound Name | 4-(2-fluorophenyl)-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 23090222 |
| Molecular Formula | C10H7FO4 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 4-(2-fluorophenyl)-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1ccccc1F |
| InChI | InChI=1S/C10H7FO4/c11-7-4-2-1-3-6(7)8(12)5-9(13)10(14)15/h1-4H,5H2,(H,14,15) |
| InChIKey | XWLTWDLBAOMBJP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|