About lithium 2-fluorobenzoate
lithium 2-fluorobenzoate (PubChem CID 19205780) has the molecular formula C7H4FLiO2
and a molecular weight of 146.05 g/mol. Its IUPAC name is lithium 2-fluorobenzoate.
Molecular Properties
| Compound Name | lithium 2-fluorobenzoate |
| PubChem CID | 19205780 |
| Molecular Formula | C7H4FLiO2 |
| Molecular Weight | 146.05 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | lithium 2-fluorobenzoate |
| SMILES | O=C([O-])c1ccccc1F.[Li+] |
| InChI | InChI=1S/C7H5FO2.Li/c8-6-4-2-1-3-5(6)7(9)10;/h1-4H,(H,9,10);/q;+1/p-1 |
| InChIKey | GMNYABASKJXTFJ-UHFFFAOYSA-M |
| XLogP | -2.81 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.05 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-fluorobenzoate?
The IUPAC name of lithium 2-fluorobenzoate (CID 19205780) is lithium 2-fluorobenzoate.
What is the SMILES notation for lithium 2-fluorobenzoate?
The canonical SMILES for lithium 2-fluorobenzoate is O=C([O-])c1ccccc1F.[Li+].
What is the InChIKey of lithium 2-fluorobenzoate?
The InChIKey is GMNYABASKJXTFJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5FO2.Li/c8-6-4-2-1-3-5(6)7(9)10;/h1-4H,(H,9,10);/q;+1/p-1.
What are the key properties of lithium 2-fluorobenzoate?
lithium 2-fluorobenzoate has a molecular weight of 146.05 g/mol, XLogP of -2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-fluorobenzoate is sourced from PubChem (CID 19205780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).