About 2-fluorobenzoate;triphenylsulfanium
2-fluorobenzoate;triphenylsulfanium (PubChem CID 22345030) has the molecular formula C25H19FO2S
and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-fluorobenzoate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2-fluorobenzoate;triphenylsulfanium |
| PubChem CID | 22345030 |
| Molecular Formula | C25H19FO2S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-fluorobenzoate;triphenylsulfanium |
| SMILES | O=C([O-])c1ccccc1F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C7H5FO2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-6-4-2-1-3-5(6)7(9)10/h1-15H;1-4H,(H,9,10)/q+1;/p-1 |
| InChIKey | KHEBGNMBMCYIBT-UHFFFAOYSA-M |
| XLogP | 4.97 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorobenzoate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobenzoate;triphenylsulfanium?
The IUPAC name of 2-fluorobenzoate;triphenylsulfanium (CID 22345030) is 2-fluorobenzoate;triphenylsulfanium.
What is the SMILES notation for 2-fluorobenzoate;triphenylsulfanium?
The canonical SMILES for 2-fluorobenzoate;triphenylsulfanium is O=C([O-])c1ccccc1F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-fluorobenzoate;triphenylsulfanium?
The InChIKey is KHEBGNMBMCYIBT-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C7H5FO2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-6-4-2-1-3-5(6)7(9)10/h1-15H;1-4H,(H,9,10)/q+1;/p-1.
What are the key properties of 2-fluorobenzoate;triphenylsulfanium?
2-fluorobenzoate;triphenylsulfanium has a molecular weight of 402.49 g/mol, XLogP of 4.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobenzoate;triphenylsulfanium is sourced from PubChem (CID 22345030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).