4-(2-aminophenyl)-2,4-dioxobutanoic acid

C10H9NO4 — CID 472

IUPAC4-(2-aminophenyl)-2,4-dioxobutanoic acid
SMILESNc1ccccc1C(=O)CC(=O)C(=O)O
InChIInChI=1S/C10H9NO4/c11-7-4-2-1-3-6(7)8(12)5-9(13)10(14)15/h1-4H,5,11H2,(H,14,15)
InChIKeyCAOVWYZQMPNAFJ-UHFFFAOYSA-N
MW207.19 g/mol
LogP0.50
Rot. Bonds4

About 4-(2-aminophenyl)-2,4-dioxobutanoic acid

4-(2-aminophenyl)-2,4-dioxobutanoic acid (PubChem CID 472) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 4-(2-aminophenyl)-2,4-dioxobutanoic acid.

Molecular Properties

Compound Name4-(2-aminophenyl)-2,4-dioxobutanoic acid
PubChem CID472
Molecular FormulaC10H9NO4
Molecular Weight207.19 g/mol
Exact Mass207.05
IUPAC Name4-(2-aminophenyl)-2,4-dioxobutanoic acid
SMILESNc1ccccc1C(=O)CC(=O)C(=O)O
InChIInChI=1S/C10H9NO4/c11-7-4-2-1-3-6(7)8(12)5-9(13)10(14)15/h1-4H,5,11H2,(H,14,15)
InChIKeyCAOVWYZQMPNAFJ-UHFFFAOYSA-N
XLogP0.50
TPSA97.46 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.19
LogP ≤ 50.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 4-(2-aminophenyl)-2,4-dioxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-aminophenyl)-2,4-dioxobutanoic acid?
The IUPAC name of 4-(2-aminophenyl)-2,4-dioxobutanoic acid (CID 472) is 4-(2-aminophenyl)-2,4-dioxobutanoic acid.
What is the SMILES notation for 4-(2-aminophenyl)-2,4-dioxobutanoic acid?
The canonical SMILES for 4-(2-aminophenyl)-2,4-dioxobutanoic acid is Nc1ccccc1C(=O)CC(=O)C(=O)O.
What is the InChIKey of 4-(2-aminophenyl)-2,4-dioxobutanoic acid?
The InChIKey is CAOVWYZQMPNAFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4/c11-7-4-2-1-3-6(7)8(12)5-9(13)10(14)15/h1-4H,5,11H2,(H,14,15).
What are the key properties of 4-(2-aminophenyl)-2,4-dioxobutanoic acid?
4-(2-aminophenyl)-2,4-dioxobutanoic acid has a molecular weight of 207.19 g/mol, XLogP of 0.50, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminophenyl)-2,4-dioxobutanoic acid is sourced from PubChem (CID 472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).