C8H8ClNO — CID 169433412
1-(6-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-chloro(1,2-13C2)ethanone (PubChem CID 169433412) has the molecular formula C8H8ClNO and a molecular weight of 177.55 g/mol. Its IUPAC name is 1-(6-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-chloro(1,2-13C2)ethanone.
| Compound Name | 1-(6-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-chloro(1,2-13C2)ethanone |
|---|---|
| PubChem CID | 169433412 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 177.55 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 1-(6-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-chloro(1,2-13C2)ethanone |
| SMILES | N[13c]1[13cH][13cH][13cH][13cH][13c]1[13C](=O)[13CH2]Cl |
| InChI | InChI=1S/C8H8ClNO/c9-5-8(11)6-3-1-2-4-7(6)10/h1-4H,5,10H2/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1 |
| InChIKey | HWIRWNKBVWOIGM-LLXNCONNSA-N |
| XLogP | 1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|