C14H16O5 — CID 510692
4-(2-butoxyphenyl)-2,4-dioxobutanoic acid (PubChem CID 510692) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-(2-butoxyphenyl)-2,4-dioxobutanoic acid.
| Compound Name | 4-(2-butoxyphenyl)-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 510692 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-(2-butoxyphenyl)-2,4-dioxobutanoic acid |
| SMILES | CCCCOc1ccccc1C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C14H16O5/c1-2-3-8-19-13-7-5-4-6-10(13)11(15)9-12(16)14(17)18/h4-7H,2-3,8-9H2,1H3,(H,17,18) |
| InChIKey | DLKYGZLQGSZMLW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|