C10H9FO2 — CID 15169784
1-(2-fluorophenyl)butane-1,3-dione (PubChem CID 15169784) has the molecular formula C10H9FO2 and a molecular weight of 180.18 g/mol. Its IUPAC name is 1-(2-fluorophenyl)butane-1,3-dione.
| Compound Name | 1-(2-fluorophenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 15169784 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 1-(2-fluorophenyl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1ccccc1F |
| InChI | InChI=1S/C10H9FO2/c1-7(12)6-10(13)8-4-2-3-5-9(8)11/h2-5H,6H2,1H3 |
| InChIKey | QAATXOWVMCBFEC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|