C22H23N3O2S — CID 5431602
N-[(Z)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]-1-benzothiophene-3-carboxamide (PubChem CID 5431602) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(Z)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(Z)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5431602 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[(Z)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]-1-benzothiophene-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1csc2ccccc12)c1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H23N3O2S/c1-14(15-8-7-9-16(12-15)23-21(27)22(2,3)4)24-25-20(26)18-13-28-19-11-6-5-10-17(18)19/h5-13H,1-4H3,(H,23,27)(H,25,26)/b24-14- |
| InChIKey | SATCCSNULFFWHA-OYKKKHCWSA-N |
| XLogP | 5.04 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|