C22H21N3O4S — CID 17349525
N-[3-[(E)-N-[(3,5-dihydroxybenzoyl)amino]-C-methylcarbonimidoyl]phenyl]-4,5-dimethylthiophene-3-carboxamide (PubChem CID 17349525) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[3-[(E)-N-[(3,5-dihydroxybenzoyl)amino]-C-methylcarbonimidoyl]phenyl]-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-[3-[(E)-N-[(3,5-dihydroxybenzoyl)amino]-C-methylcarbonimidoyl]phenyl]-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 17349525 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-[3-[(E)-N-[(3,5-dihydroxybenzoyl)amino]-C-methylcarbonimidoyl]phenyl]-4,5-dimethylthiophene-3-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc(O)cc(O)c1)c1cccc(NC(=O)c2csc(C)c2C)c1 |
| InChI | InChI=1S/C22H21N3O4S/c1-12-14(3)30-11-20(12)22(29)23-17-6-4-5-15(7-17)13(2)24-25-21(28)16-8-18(26)10-19(27)9-16/h4-11,26-27H,1-3H3,(H,23,29)(H,25,28)/b24-13+ |
| InChIKey | CRRMELLIQGVYRS-ZMOGYAJESA-N |
| XLogP | 4.18 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|