C15H14N2O4 — CID 17126860
3,5-dihydroxy-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]benzamide (PubChem CID 17126860) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]benzamide.
| Compound Name | 3,5-dihydroxy-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 17126860 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3,5-dihydroxy-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1cc(O)cc(O)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C15H14N2O4/c1-9(10-3-2-4-12(18)5-10)16-17-15(21)11-6-13(19)8-14(20)7-11/h2-8,18-20H,1H3,(H,17,21)/b16-9+ |
| InChIKey | WDTUINPNWZJGIZ-CXUHLZMHSA-N |
| XLogP | 1.96 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|