C19H20N4O4 — CID 172984598
N,N'-bis[(E)-1-(3-hydroxyphenyl)ethylideneamino]propanediamide (PubChem CID 172984598) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is N,N'-bis[(E)-1-(3-hydroxyphenyl)ethylideneamino]propanediamide.
| Compound Name | N,N'-bis[(E)-1-(3-hydroxyphenyl)ethylideneamino]propanediamide |
|---|---|
| PubChem CID | 172984598 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N,N'-bis[(E)-1-(3-hydroxyphenyl)ethylideneamino]propanediamide |
| SMILES | C/C(=N\NC(=O)CC(=O)N/N=C(\C)c1cccc(O)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C19H20N4O4/c1-12(14-5-3-7-16(24)9-14)20-22-18(26)11-19(27)23-21-13(2)15-6-4-8-17(25)10-15/h3-10,24-25H,11H2,1-2H3,(H,22,26)(H,23,27)/b20-12+,21-13+ |
| InChIKey | YKBDEIOIKOLGGR-ZIOPAAQOSA-N |
| XLogP | 1.87 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|