C18H28N2O2 — CID 19685450
N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]decanamide (PubChem CID 19685450) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]decanamide.
| Compound Name | N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]decanamide |
|---|---|
| PubChem CID | 19685450 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]decanamide |
| SMILES | CCCCCCCCCC(=O)N/N=C(\C)c1cccc(O)c1 |
| InChI | InChI=1S/C18H28N2O2/c1-3-4-5-6-7-8-9-13-18(22)20-19-15(2)16-11-10-12-17(21)14-16/h10-12,14,21H,3-9,13H2,1-2H3,(H,20,22)/b19-15+ |
| InChIKey | NLVQHWYYKPJYCT-XDJHFCHBSA-N |
| XLogP | 4.37 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|