C24H30N4O2 — CID 4173231
N,N'-bis[1-(3-methylphenyl)ethylideneamino]hexanediamide (PubChem CID 4173231) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N,N'-bis[1-(3-methylphenyl)ethylideneamino]hexanediamide.
| Compound Name | N,N'-bis[1-(3-methylphenyl)ethylideneamino]hexanediamide |
|---|---|
| PubChem CID | 4173231 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N,N'-bis[1-(3-methylphenyl)ethylideneamino]hexanediamide |
| SMILES | CC(=NNC(=O)CCCCC(=O)NN=C(C)c1cccc(C)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C24H30N4O2/c1-17-9-7-11-21(15-17)19(3)25-27-23(29)13-5-6-14-24(30)28-26-20(4)22-12-8-10-18(2)16-22/h7-12,15-16H,5-6,13-14H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | SQMDTXUYZXHOHN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|