C19H29BrN2O — CID 19685706
N-[(E)-1-(3-bromophenyl)ethylideneamino]undecanamide (PubChem CID 19685706) has the molecular formula C19H29BrN2O and a molecular weight of 381.36 g/mol. Its IUPAC name is N-[(E)-1-(3-bromophenyl)ethylideneamino]undecanamide.
| Compound Name | N-[(E)-1-(3-bromophenyl)ethylideneamino]undecanamide |
|---|---|
| PubChem CID | 19685706 |
| Molecular Formula | C19H29BrN2O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[(E)-1-(3-bromophenyl)ethylideneamino]undecanamide |
| SMILES | CCCCCCCCCCC(=O)N/N=C(\C)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H29BrN2O/c1-3-4-5-6-7-8-9-10-14-19(23)22-21-16(2)17-12-11-13-18(20)15-17/h11-13,15H,3-10,14H2,1-2H3,(H,22,23)/b21-16+ |
| InChIKey | GCDQOKKBFQJCGF-LTGZKZEYSA-N |
| XLogP | 5.82 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|