C21H24N4O4 — CID 4204906
N,N'-bis[1-(3-hydroxyphenyl)ethylideneamino]pentanediamide (PubChem CID 4204906) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N,N'-bis[1-(3-hydroxyphenyl)ethylideneamino]pentanediamide.
| Compound Name | N,N'-bis[1-(3-hydroxyphenyl)ethylideneamino]pentanediamide |
|---|---|
| PubChem CID | 4204906 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N,N'-bis[1-(3-hydroxyphenyl)ethylideneamino]pentanediamide |
| SMILES | CC(=NNC(=O)CCCC(=O)NN=C(C)c1cccc(O)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C21H24N4O4/c1-14(16-6-3-8-18(26)12-16)22-24-20(28)10-5-11-21(29)25-23-15(2)17-7-4-9-19(27)13-17/h3-4,6-9,12-13,26-27H,5,10-11H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | FITCVPQVECVWPT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|