C17H26N2O3 — CID 136717836
N-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]nonanamide (PubChem CID 136717836) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]nonanamide.
| Compound Name | N-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]nonanamide |
|---|---|
| PubChem CID | 136717836 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]nonanamide |
| SMILES | CCCCCCCCC(=O)N/N=C(/C)c1ccc(O)cc1O |
| InChI | InChI=1S/C17H26N2O3/c1-3-4-5-6-7-8-9-17(22)19-18-13(2)15-11-10-14(20)12-16(15)21/h10-12,20-21H,3-9H2,1-2H3,(H,19,22)/b18-13- |
| InChIKey | CEMBSTLLGHLHQG-AQTBWJFISA-N |
| XLogP | 3.69 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|