C20H23N3O4 — CID 3677655
N'-[1-(2,4-dihydroxyphenyl)ethylideneamino]-N-(2,5-dimethylphenyl)butanediamide (PubChem CID 3677655) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N'-[1-(2,4-dihydroxyphenyl)ethylideneamino]-N-(2,5-dimethylphenyl)butanediamide.
| Compound Name | N'-[1-(2,4-dihydroxyphenyl)ethylideneamino]-N-(2,5-dimethylphenyl)butanediamide |
|---|---|
| PubChem CID | 3677655 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N'-[1-(2,4-dihydroxyphenyl)ethylideneamino]-N-(2,5-dimethylphenyl)butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)Nc1cc(C)ccc1C)c1ccc(O)cc1O |
| InChI | InChI=1S/C20H23N3O4/c1-12-4-5-13(2)17(10-12)21-19(26)8-9-20(27)23-22-14(3)16-7-6-15(24)11-18(16)25/h4-7,10-11,24-25H,8-9H2,1-3H3,(H,21,26)(H,23,27) |
| InChIKey | IQKUTJGWFRLNRF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|