C19H27N3O4 — CID 7269735
ethyl (2R,3Z)-3-[[4-(2,5-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]-2-methylbutanoate (PubChem CID 7269735) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl (2R,3Z)-3-[[4-(2,5-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]-2-methylbutanoate.
| Compound Name | ethyl (2R,3Z)-3-[[4-(2,5-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]-2-methylbutanoate |
|---|---|
| PubChem CID | 7269735 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | ethyl (2R,3Z)-3-[[4-(2,5-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]-2-methylbutanoate |
| SMILES | CCOC(=O)[C@H](C)/C(C)=N\NC(=O)CCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C19H27N3O4/c1-6-26-19(25)14(4)15(5)21-22-18(24)10-9-17(23)20-16-11-12(2)7-8-13(16)3/h7-8,11,14H,6,9-10H2,1-5H3,(H,20,23)(H,22,24)/b21-15-/t14-/m1/s1 |
| InChIKey | MQIGXIUEQKDHKG-PKJRHQKLSA-N |
| XLogP | 2.71 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|