C17H21Cl2N3O4 — CID 4659588
ethyl 3-[[4-(2,4-dichloroanilino)-4-oxobutanoyl]hydrazinylidene]-2-methylbutanoate (PubChem CID 4659588) has the molecular formula C17H21Cl2N3O4 and a molecular weight of 402.28 g/mol. Its IUPAC name is ethyl 3-[[4-(2,4-dichloroanilino)-4-oxobutanoyl]hydrazinylidene]-2-methylbutanoate.
| Compound Name | ethyl 3-[[4-(2,4-dichloroanilino)-4-oxobutanoyl]hydrazinylidene]-2-methylbutanoate |
|---|---|
| PubChem CID | 4659588 |
| Molecular Formula | C17H21Cl2N3O4 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | ethyl 3-[[4-(2,4-dichloroanilino)-4-oxobutanoyl]hydrazinylidene]-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)C(C)=NNC(=O)CCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N3O4/c1-4-26-17(25)10(2)11(3)21-22-16(24)8-7-15(23)20-14-6-5-12(18)9-13(14)19/h5-6,9-10H,4,7-8H2,1-3H3,(H,20,23)(H,22,24) |
| InChIKey | CTQYQZKIOPDKRE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|