C18H18N2O4 — CID 17126917
3,5-dihydroxy-N-[(E)-1-(3-prop-2-enoxyphenyl)ethylideneamino]benzamide (PubChem CID 17126917) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(E)-1-(3-prop-2-enoxyphenyl)ethylideneamino]benzamide.
| Compound Name | 3,5-dihydroxy-N-[(E)-1-(3-prop-2-enoxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 17126917 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3,5-dihydroxy-N-[(E)-1-(3-prop-2-enoxyphenyl)ethylideneamino]benzamide |
| SMILES | C=CCOc1cccc(/C(C)=N/NC(=O)c2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C18H18N2O4/c1-3-7-24-17-6-4-5-13(10-17)12(2)19-20-18(23)14-8-15(21)11-16(22)9-14/h3-6,8-11,21-22H,1,7H2,2H3,(H,20,23)/b19-12+ |
| InChIKey | PDMLTSYOOAQDTL-XDHOZWIPSA-N |
| XLogP | 2.82 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|