C24H17Cl2N3O2S — CID 6032132
3-chloro-N-[(Z)-1-[3-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 6032132) has the molecular formula C24H17Cl2N3O2S and a molecular weight of 482.39 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-1-[3-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(Z)-1-[3-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6032132 |
| Molecular Formula | C24H17Cl2N3O2S |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 3-chloro-N-[(Z)-1-[3-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1sc2ccccc2c1Cl)c1cccc(NC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H17Cl2N3O2S/c1-14(28-29-24(31)22-21(26)19-7-2-3-8-20(19)32-22)16-5-4-6-18(13-16)27-23(30)15-9-11-17(25)12-10-15/h2-13H,1H3,(H,27,30)(H,29,31)/b28-14- |
| InChIKey | YPGHHPVWFMARAF-MUXKCCDJSA-N |
| XLogP | 6.61 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|