C22H22N4O4 — CID 90061604
3,4-dimethoxy-N-[2-oxo-2-[(2E)-2-(1-quinolin-4-ylethylidene)hydrazinyl]ethyl]benzamide (PubChem CID 90061604) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-oxo-2-[(2E)-2-(1-quinolin-4-ylethylidene)hydrazinyl]ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-oxo-2-[(2E)-2-(1-quinolin-4-ylethylidene)hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 90061604 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3,4-dimethoxy-N-[2-oxo-2-[(2E)-2-(1-quinolin-4-ylethylidene)hydrazinyl]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)N/N=C(\C)c2ccnc3ccccc23)cc1OC |
| InChI | InChI=1S/C22H22N4O4/c1-14(16-10-11-23-18-7-5-4-6-17(16)18)25-26-21(27)13-24-22(28)15-8-9-19(29-2)20(12-15)30-3/h4-12H,13H2,1-3H3,(H,24,28)(H,26,27)/b25-14+ |
| InChIKey | IEMXVWITSQIPPB-AFUMVMLFSA-N |
| XLogP | 2.52 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|