C28H32FN3O5S — CID 90061618
N-[2-[(2E)-2-[2-cyclohexyl-1-(7-fluoro-1-benzothiophen-3-yl)ethylidene]hydrazinyl]-2-oxoethyl]-4-(2-hydroxyethoxy)-3-methoxybenzamide (PubChem CID 90061618) has the molecular formula C28H32FN3O5S and a molecular weight of 541.65 g/mol. Its IUPAC name is N-[2-[(2E)-2-[2-cyclohexyl-1-(7-fluoro-1-benzothiophen-3-yl)ethylidene]hydrazinyl]-2-oxoethyl]-4-(2-hydroxyethoxy)-3-methoxybenzamide.
| Compound Name | N-[2-[(2E)-2-[2-cyclohexyl-1-(7-fluoro-1-benzothiophen-3-yl)ethylidene]hydrazinyl]-2-oxoethyl]-4-(2-hydroxyethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 90061618 |
| Molecular Formula | C28H32FN3O5S |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | N-[2-[(2E)-2-[2-cyclohexyl-1-(7-fluoro-1-benzothiophen-3-yl)ethylidene]hydrazinyl]-2-oxoethyl]-4-(2-hydroxyethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)N/N=C(\CC2CCCCC2)c2csc3c(F)cccc23)ccc1OCCO |
| InChI | InChI=1S/C28H32FN3O5S/c1-36-25-15-19(10-11-24(25)37-13-12-33)28(35)30-16-26(34)32-31-23(14-18-6-3-2-4-7-18)21-17-38-27-20(21)8-5-9-22(27)29/h5,8-11,15,17-18,33H,2-4,6-7,12-14,16H2,1H3,(H,30,35)(H,32,34)/b31-23+ |
| InChIKey | WHOOUDRKLIEIJR-UQRQXUALSA-N |
| XLogP | 4.64 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|