C15H17NO2 — CID 141154301
2-[2-(3,4-dimethoxyphenyl)prop-2-enyl]-1H-pyrrole (PubChem CID 141154301) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)prop-2-enyl]-1H-pyrrole.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)prop-2-enyl]-1H-pyrrole |
|---|---|
| PubChem CID | 141154301 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)prop-2-enyl]-1H-pyrrole |
| SMILES | C=C(Cc1ccc[nH]1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H17NO2/c1-11(9-13-5-4-8-16-13)12-6-7-14(17-2)15(10-12)18-3/h4-8,10,16H,1,9H2,2-3H3 |
| InChIKey | NRMZMUJTMULSES-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |